CAS 5590-43-2 appears in our catalog under these names: 5-Bromo-2,3-dihydrobenzofuran-3-ol, 95+%, 5-Bromo-2,3-dihydro-1-benzofuran-3-ol. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 50mg, 0,5g.
5-bromo-2,3-dihydro-1-benzofuran-3-ol (CAS 5590-43-2) is a chemical compound with the molecular formula C8H7BrO2 and a molecular weight of 215.04 g/mol. IUPAC name: 5-bromo-2,3-dihydro-1-benzofuran-3-ol. InChIKey: QKYZCEGIXWRWLB-UHFFFAOYSA-N.
| Molecular formula | C8H7BrO2 |
|---|---|
| Molecular weight | 215.04 g/mol |
| IUPAC name | 5-bromo-2,3-dihydro-1-benzofuran-3-ol |
| InChIKey | QKYZCEGIXWRWLB-UHFFFAOYSA-N |
| SMILES | C1C(C2=C(O1)C=CC(=C2)Br)O |
Computed by PubChem (NCBI)