Products 5590-44-3
CAS 5590-44-3 is the registry number for 5-Chloro-2,3-dihydro-3-benzofuranol, >95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg.
5-chloro-2,3-dihydro-1-benzofuran-3-ol (CAS 5590-44-3) is a chemical compound with the molecular formula C8H7ClO2 and a molecular weight of 170.59 g/mol. IUPAC name: 5-chloro-2,3-dihydro-1-benzofuran-3-ol. InChIKey: ZSLZIDPXEPQVEH-UHFFFAOYSA-N.
| Molecular formula | C8H7ClO2 |
|---|---|
| Molecular weight | 170.59 g/mol |
| IUPAC name | 5-chloro-2,3-dihydro-1-benzofuran-3-ol |
| InChIKey | ZSLZIDPXEPQVEH-UHFFFAOYSA-N |
| SMILES | C1C(C2=C(O1)C=CC(=C2)Cl)O |
Computed by PubChem (NCBI)