Products 55904-83-1

CAS 55904-83-1 is the registry number for 3,4-Dimethoxy-1,2,5-thiadiazole 1,1-dioxide 95+%. Offered by: Ambeed. Available pack sizes: 50mg, 100mg, 250mg, 1g.

Structural formula: {0} (CAS {1})

3,4-dimethoxy-1,2,5-thiadiazole 1,1-dioxide (CAS 55904-83-1) is a chemical compound with the molecular formula C4H6N2O4S and a molecular weight of 178.17 g/mol. IUPAC name: 3,4-dimethoxy-1,2,5-thiadiazole 1,1-dioxide. InChIKey: ZRSLQBDTGLCFJJ-UHFFFAOYSA-N.

Identity
Molecular formulaC4H6N2O4S
Molecular weight178.17 g/mol
IUPAC name3,4-dimethoxy-1,2,5-thiadiazole 1,1-dioxide
InChIKeyZRSLQBDTGLCFJJ-UHFFFAOYSA-N
SMILESCOC1=NS(=O)(=O)N=C1OC

Computed by PubChem (NCBI)