CAS 55907-61-4 appears in our catalog under these names: 2,4-Dinitrophenylhydrazine Hydrochloride, >95% (HPLC), 2,4–Dinitrophenylhydrazine Hydrochloride, 2,4–Dinitrophenylhydrazine Hydrochloride (for HPLC Labeling), 2,4-Dinitrophenylhydrazine Hydrochloride, 2,4-Dinitrophenylhydrazine Hydrochloride [for HPLC Labeling], >98.0%(HPLC)(T). Offered by: TRC, GLPBio, Biosynth, TCI, Chemat. Available pack sizes: 2,5g, 250mg, 500mg, 100g, 25g, 5g, 1g, 250g.
(2,4-dinitrophenyl)hydrazine;hydrochloride (CAS 55907-61-4) is a chemical compound with the molecular formula C6H7ClN4O4 and a molecular weight of 234.60 g/mol. IUPAC name: (2,4-dinitrophenyl)hydrazine;hydrochloride. InChIKey: PUYFAZQODQZOFK-UHFFFAOYSA-N.
| Molecular formula | C6H7ClN4O4 |
|---|---|
| Molecular weight | 234.60 g/mol |
| IUPAC name | (2,4-dinitrophenyl)hydrazine;hydrochloride |
| InChIKey | PUYFAZQODQZOFK-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1[N+](=O)[O-])[N+](=O)[O-])NN.Cl |
Computed by PubChem (NCBI)