CAS 55939-13-4 is the registry number for 3-Acenaphthenamine. Offered by: TRC, Biosynth. Available pack sizes: 10mg, 25mg, 5mg, 50mg, 100mg.
1,2-dihydroacenaphthylen-3-amine (CAS 55939-13-4) is a chemical compound with the molecular formula C12H11N and a molecular weight of 169.22 g/mol. IUPAC name: 1,2-dihydroacenaphthylen-3-amine. InChIKey: OUYJCKISKGRXRJ-UHFFFAOYSA-N.
| Molecular formula | C12H11N |
|---|---|
| Molecular weight | 169.22 g/mol |
| IUPAC name | 1,2-dihydroacenaphthylen-3-amine |
| InChIKey | OUYJCKISKGRXRJ-UHFFFAOYSA-N |
| SMILES | C1CC2=C(C=CC3=C2C1=CC=C3)N |
Computed by PubChem (NCBI)