Products 55939-13-4

CAS 55939-13-4 is the registry number for 3-Acenaphthenamine. Offered by: TRC, Biosynth. Available pack sizes: 10mg, 25mg, 5mg, 50mg, 100mg.

Structural formula: {0} (CAS {1})

1,2-dihydroacenaphthylen-3-amine (CAS 55939-13-4) is a chemical compound with the molecular formula C12H11N and a molecular weight of 169.22 g/mol. IUPAC name: 1,2-dihydroacenaphthylen-3-amine. InChIKey: OUYJCKISKGRXRJ-UHFFFAOYSA-N.

Identity
Molecular formulaC12H11N
Molecular weight169.22 g/mol
IUPAC name1,2-dihydroacenaphthylen-3-amine
InChIKeyOUYJCKISKGRXRJ-UHFFFAOYSA-N
SMILESC1CC2=C(C=CC3=C2C1=CC=C3)N

Computed by PubChem (NCBI)