CAS 5594-90-1 is the registry number for Bis(perfluorophenyl)(phenyl)phosphine oxide, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
1,2,3,4,5-pentafluoro-6-[(2,3,4,5,6-pentafluorophenyl)-phenylphosphoryl]benzene (CAS 5594-90-1) is a chemical compound with the molecular formula C18H5F10OP and a molecular weight of 458.2 g/mol. IUPAC name: 1,2,3,4,5-pentafluoro-6-[(2,3,4,5,6-pentafluorophenyl)-phenylphosphoryl]benzene. InChIKey: MMDKBGZCHVGKCO-UHFFFAOYSA-N.
| Molecular formula | C18H5F10OP |
|---|---|
| Molecular weight | 458.2 g/mol |
| IUPAC name | 1,2,3,4,5-pentafluoro-6-[(2,3,4,5,6-pentafluorophenyl)-phenylphosphoryl]benzene |
| InChIKey | MMDKBGZCHVGKCO-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)P(=O)(C2=C(C(=C(C(=C2F)F)F)F)F)C3=C(C(=C(C(=C3F)F)F)F)F |
Computed by PubChem (NCBI)