CAS 55940-03-9 appears in our catalog under these names: Bis(ethylcyclopentadienyl) Chromium(II), Bis(ethylcyclopentadienyl)chromium, Bis(ethylcyclopentadienyl) Chromium(II), 99.9% trace metals basis, 99.9% trace metals basis. Offered by: TRC, GLPBio, Chemat. Available pack sizes: 1g, 5g, 250mg.
CAS 55940-03-9 identifies a chemical compound with the molecular formula C14H18Cr and a molecular weight of 238.29 g/mol. InChIKey: OZUJAILVLUFQME-UHFFFAOYSA-N.
| Molecular formula | C14H18Cr |
|---|---|
| Molecular weight | 238.29 g/mol |
| InChIKey | OZUJAILVLUFQME-UHFFFAOYSA-N |
| SMILES | CC[C]1[CH][CH][CH][CH]1.CC[C]1[CH][CH][CH][CH]1.[Cr] |
Computed by PubChem (NCBI)