CAS 55940-04-0 is the registry number for Bis(ethylcyclopentadienyl)vanadium(II), 95+%. Offered by: Chemat Brand. Available pack sizes: on request.
Bis(1-ethylcyclopenta-1,3-diene);vanadium(2+) (CAS 55940-04-0) is a chemical compound with the molecular formula C14H18V and a molecular weight of 237.23 g/mol. IUPAC name: bis(1-ethylcyclopenta-1,3-diene);vanadium(2+). InChIKey: OZUHIGOGAVKLSX-UHFFFAOYSA-N.
| Molecular formula | C14H18V |
|---|---|
| Molecular weight | 237.23 g/mol |
| IUPAC name | bis(1-ethylcyclopenta-1,3-diene);vanadium(2+) |
| InChIKey | OZUHIGOGAVKLSX-UHFFFAOYSA-N |
| SMILES | CCC1=CC=C[CH-]1.CCC1=CC=C[CH-]1.[V+2] |
Computed by PubChem (NCBI)