Products 5596-04-3

CAS 5596-04-3 is the registry number for 3-Ethyl-sydnone imine hydrochloride, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 250mg, 1g.

Structural formula: {0} (CAS {1})

3-ethyloxadiazol-3-ium-5-amine chloride (CAS 5596-04-3) is a chemical compound with the molecular formula C4H8ClN3O and a molecular weight of 149.58 g/mol. IUPAC name: 3-ethyloxadiazol-3-ium-5-amine chloride. InChIKey: GSOHYOBUFVCQDP-UHFFFAOYSA-M.

Identity
Molecular formulaC4H8ClN3O
Molecular weight149.58 g/mol
IUPAC name3-ethyloxadiazol-3-ium-5-amine chloride
InChIKeyGSOHYOBUFVCQDP-UHFFFAOYSA-M
SMILESCC[N+]1=NOC(=C1)N.[Cl-]

Computed by PubChem (NCBI)