CAS 55982-15-5 appears in our catalog under these names: Dutasteride Impurity 22, 2,2,2-Trifluoro-N-(trimethylsilyl)acetamide. Offered by: Chemat Brand, Biosynth. Available pack sizes: on request, 50mg.
2,2,2-trifluoro-N-trimethylsilylacetamide (CAS 55982-15-5) is a chemical compound with the molecular formula C5H10F3NOSi and a molecular weight of 185.22 g/mol. IUPAC name: 2,2,2-trifluoro-N-trimethylsilylacetamide. InChIKey: QLPZEDHKVHQPAD-UHFFFAOYSA-N.
| Molecular formula | C5H10F3NOSi |
|---|---|
| Molecular weight | 185.22 g/mol |
| IUPAC name | 2,2,2-trifluoro-N-trimethylsilylacetamide |
| InChIKey | QLPZEDHKVHQPAD-UHFFFAOYSA-N |
| SMILES | C[Si](C)(C)NC(=O)C(F)(F)F |
Computed by PubChem (NCBI)