CAS 56009-91-7 is the registry number for Phenyl 2-pyridyl ketone hydrazone, 95-<97%. Offered by: Hoffman Fine Chemicals. Available pack sizes: 10g, 25g, 50g, 100g.
[phenyl(pyridin-2-yl)methylidene]hydrazine (CAS 56009-91-7) is a chemical compound with the molecular formula C12H11N3 and a molecular weight of 197.24 g/mol. IUPAC name: [phenyl(pyridin-2-yl)methylidene]hydrazine. InChIKey: NPIHYGZWEUGMNG-UHFFFAOYSA-N.
| Molecular formula | C12H11N3 |
|---|---|
| Molecular weight | 197.24 g/mol |
| IUPAC name | [phenyl(pyridin-2-yl)methylidene]hydrazine |
| InChIKey | NPIHYGZWEUGMNG-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C(=NN)C2=CC=CC=N2 |
Computed by PubChem (NCBI)