Products 56009-91-7

CAS 56009-91-7 is the registry number for Phenyl 2-pyridyl ketone hydrazone, 95-<97%. Offered by: Hoffman Fine Chemicals. Available pack sizes: 10g, 25g, 50g, 100g.

Structural formula: {0} (CAS {1})

[phenyl(pyridin-2-yl)methylidene]hydrazine (CAS 56009-91-7) is a chemical compound with the molecular formula C12H11N3 and a molecular weight of 197.24 g/mol. IUPAC name: [phenyl(pyridin-2-yl)methylidene]hydrazine. InChIKey: NPIHYGZWEUGMNG-UHFFFAOYSA-N.

Identity
Molecular formulaC12H11N3
Molecular weight197.24 g/mol
IUPAC name[phenyl(pyridin-2-yl)methylidene]hydrazine
InChIKeyNPIHYGZWEUGMNG-UHFFFAOYSA-N
SMILESC1=CC=C(C=C1)C(=NN)C2=CC=CC=N2

Computed by PubChem (NCBI)