Products 560111-91-3
CAS 560111-91-3 is the registry number for FK3453. Offered by: MedChemExpress. Available pack sizes: Get quote.
6-(2-amino-4-phenylpyrimidin-5-yl)-2-propan-2-ylpyridazin-3-one (CAS 560111-91-3) is a chemical compound with the molecular formula C17H17N5O and a molecular weight of 307.35 g/mol. IUPAC name: 6-(2-amino-4-phenylpyrimidin-5-yl)-2-propan-2-ylpyridazin-3-one. InChIKey: QECZSUGQZHURLI-UHFFFAOYSA-N.
| Molecular formula | C17H17N5O |
|---|---|
| Molecular weight | 307.35 g/mol |
| IUPAC name | 6-(2-amino-4-phenylpyrimidin-5-yl)-2-propan-2-ylpyridazin-3-one |
| InChIKey | QECZSUGQZHURLI-UHFFFAOYSA-N |
| SMILES | CC(C)N1C(=O)C=CC(=N1)C2=CN=C(N=C2C3=CC=CC=C3)N |
Computed by PubChem (NCBI)