CAS 56039-58-8 appears in our catalog under these names: Benzylidene Camphor Sulfonic Acid, Benzylidene Camphor Sulfonic Acid, >95% (HPLC), Benzylidenecamphor sulfonic acid, 4-[(4,7,7-Trimethyl-3-oxobicyclo[2.2.1]hept-2-ylidene)methyl]benzenesulfonic acid, 97%, 97%. Offered by: Chemat Brand, TRC, Dr. Ehrenstorfer, Biosynth, Sigma-Aldrich. Available pack sizes: on request, 250mg, 500mg, 50mg, 10mg, 25MG, 1x10mg.
4-[(E)-(4,7,7-trimethyl-3-oxo-2-bicyclo[2.2.1]heptanylidene)methyl]benzenesulfonic acid (CAS 56039-58-8) is a chemical compound with the molecular formula C17H20O4S and a molecular weight of 320.4 g/mol. IUPAC name: 4-[(E)-(4,7,7-trimethyl-3-oxo-2-bicyclo[2.2.1]heptanylidene)methyl]benzenesulfonic acid. InChIKey: KKJKXQYVUVWWJP-JLHYYAGUSA-N.
| Molecular formula | C17H20O4S |
|---|---|
| Molecular weight | 320.4 g/mol |
| IUPAC name | 4-[(E)-(4,7,7-trimethyl-3-oxo-2-bicyclo[2.2.1]heptanylidene)methyl]benzenesulfonic acid |
| InChIKey | KKJKXQYVUVWWJP-JLHYYAGUSA-N |
| SMILES | CC1(C\2CCC1(C(=O)/C2=C/C3=CC=C(C=C3)S(=O)(=O)O)C)C |
Computed by PubChem (NCBI)