CAS 56040-80-3 is the registry number for Ceftolozane Impurity 9. Offered by: Chemat Brand. Available pack sizes: on request.
Benzhydryl (6R,7R)-7-amino-3-(chloromethyl)-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate (CAS 56040-80-3) is a chemical compound with the molecular formula C21H19ClN2O3S and a molecular weight of 414.9 g/mol. IUPAC name: benzhydryl (6R,7R)-7-amino-3-(chloromethyl)-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate. InChIKey: PBPKDMBQLUWMIO-OXQOHEQNSA-N.
| Molecular formula | C21H19ClN2O3S |
|---|---|
| Molecular weight | 414.9 g/mol |
| IUPAC name | benzhydryl (6R,7R)-7-amino-3-(chloromethyl)-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate |
| InChIKey | PBPKDMBQLUWMIO-OXQOHEQNSA-N |
| SMILES | C1C(=C(N2[C@H](S1)[C@@H](C2=O)N)C(=O)OC(C3=CC=CC=C3)C4=CC=CC=C4)CCl |
Computed by PubChem (NCBI)