CAS 56048-51-2 is the registry number for 2-(Naphthalen-2-yl)benzo(d)thiazole, 95-<97%. Offered by: Hoffman Fine Chemicals. Available pack sizes: 1g, 2,5g, 5g, 10g, 25g, 50g.
2-naphthalen-2-yl-1,3-benzothiazole (CAS 56048-51-2) is a chemical compound with the molecular formula C17H11NS and a molecular weight of 261.3 g/mol. IUPAC name: 2-naphthalen-2-yl-1,3-benzothiazole. InChIKey: IUQMQRAOHBNYAU-UHFFFAOYSA-N.
| Molecular formula | C17H11NS |
|---|---|
| Molecular weight | 261.3 g/mol |
| IUPAC name | 2-naphthalen-2-yl-1,3-benzothiazole |
| InChIKey | IUQMQRAOHBNYAU-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C=C(C=CC2=C1)C3=NC4=CC=CC=C4S3 |
Computed by PubChem (NCBI)