CAS 56048-55-6 is the registry number for 2-(Benzo[d]thiazol-2-yl)-4-(tert-butyl)phenol, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg.
2-(1,3-benzothiazol-2-yl)-4-tert-butylphenol (CAS 56048-55-6) is a chemical compound with the molecular formula C17H17NOS and a molecular weight of 283.4 g/mol. IUPAC name: 2-(1,3-benzothiazol-2-yl)-4-tert-butylphenol. InChIKey: ILXBALVBXJUCLO-UHFFFAOYSA-N.
| Molecular formula | C17H17NOS |
|---|---|
| Molecular weight | 283.4 g/mol |
| IUPAC name | 2-(1,3-benzothiazol-2-yl)-4-tert-butylphenol |
| InChIKey | ILXBALVBXJUCLO-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C1=CC(=C(C=C1)O)C2=NC3=CC=CC=C3S2 |
Computed by PubChem (NCBI)