CAS 56070-16-7 appears in our catalog under these names: Terbufos Sulfone, Terbufos-sulfone, Terbufos-sulfone 100 µg/mL in Acetonitrile, Terbufos-sulfone 1000 µg/mL in Acetone, Terbufos-sulfone, Concentration: 100 µg/ml Solvent: Acetonitrile. Offered by: Chemat Brand, TRC, Dr. Ehrenstorfer, HPC Standards. Available pack sizes: on request, 1g, 50mg, 1ml, 1x1ml.
Tert-butylsulfonylmethylsulfanyl-diethoxy-sulfanylidene-lambda5-phosphane (CAS 56070-16-7) is a chemical compound with the molecular formula C9H21O4PS3 and a molecular weight of 320.4 g/mol. IUPAC name: tert-butylsulfonylmethylsulfanyl-diethoxy-sulfanylidene-lambda5-phosphane. InChIKey: DWZSTEUTHNUVQD-UHFFFAOYSA-N.
| Molecular formula | C9H21O4PS3 |
|---|---|
| Molecular weight | 320.4 g/mol |
| IUPAC name | tert-butylsulfonylmethylsulfanyl-diethoxy-sulfanylidene-lambda5-phosphane |
| InChIKey | DWZSTEUTHNUVQD-UHFFFAOYSA-N |
| SMILES | CCOP(=S)(OCC)SCS(=O)(=O)C(C)(C)C |
Computed by PubChem (NCBI)