CAS 56070-37-2 appears in our catalog under these names: 2-O-Methyl Beta-Neuraminic Acid Methyl Ester, Methyl b-neuraminic acid methyl ester. Offered by: TRC, Biosynth. Available pack sizes: 10mg, 25mg, 5mg.
Methyl (2S,4S,5R,6R)-5-amino-4-hydroxy-2-methoxy-6-[(1R,2R)-1,2,3-trihydroxypropyl]oxane-2-carboxylate (CAS 56070-37-2) is a chemical compound with the molecular formula C11H21NO8 and a molecular weight of 295.29 g/mol. IUPAC name: methyl (2S,4S,5R,6R)-5-amino-4-hydroxy-2-methoxy-6-[(1R,2R)-1,2,3-trihydroxypropyl]oxane-2-carboxylate. InChIKey: FAXUBNUGEDSQNU-PFQGKNLYSA-N.
| Molecular formula | C11H21NO8 |
|---|---|
| Molecular weight | 295.29 g/mol |
| IUPAC name | methyl (2S,4S,5R,6R)-5-amino-4-hydroxy-2-methoxy-6-[(1R,2R)-1,2,3-trihydroxypropyl]oxane-2-carboxylate |
| InChIKey | FAXUBNUGEDSQNU-PFQGKNLYSA-N |
| SMILES | COC(=O)[C@@]1(C[C@@H]([C@H]([C@@H](O1)[C@@H]([C@@H](CO)O)O)N)O)OC |
Computed by PubChem (NCBI)