CAS 561-20-6 appears in our catalog under these names: Cacotheline monohydrate, 95%, Cacotheline Monohydrate, >98.0%(T), Cacotheline, min. 95 %, p.a., 1 g, glass, Cacotheline, min. 95 %, p.a., 10 g, glass, Cacotheline, min. 95 %, p.a., 25 g, glass. Offered by: Combi-blocks, TCI, Roth. Available pack sizes: 5g, 1g, 10g, 25g.
2-[(4S,12S,13R,14S,19R,21S)-9-nitro-7,8-dioxo-15-oxa-1,11-diazahexacyclo[16.3.1.04,12.04,21.05,10.013,19]docosa-5,9,17-trien-14-yl]acetic acid (CAS 561-20-6) is a chemical compound with the molecular formula C21H21N3O7 and a molecular weight of 427.4 g/mol. IUPAC name: 2-[(4S,12S,13R,14S,19R,21S)-9-nitro-7,8-dioxo-15-oxa-1,11-diazahexacyclo[16.3.1.04,12.04,21.05,10.013,19]docosa-5,9,17-trien-14-yl]acetic acid. InChIKey: IVEMPCACOMNRGI-OFDJEBHLSA-N.
| Molecular formula | C21H21N3O7 |
|---|---|
| Molecular weight | 427.4 g/mol |
| IUPAC name | 2-[(4S,12S,13R,14S,19R,21S)-9-nitro-7,8-dioxo-15-oxa-1,11-diazahexacyclo[16.3.1.04,12.04,21.05,10.013,19]docosa-5,9,17-trien-14-yl]acetic acid |
| InChIKey | IVEMPCACOMNRGI-OFDJEBHLSA-N |
| SMILES | C1CN2CC3=CCO[C@H]([C@@H]4[C@H]3C[C@H]2[C@@]15[C@H]4NC6=C(C(=O)C(=O)C=C56)[N+](=O)[O-])CC(=O)O |
Computed by PubChem (NCBI)