CAS 561-94-4 is the registry number for Ergosine. Offered by: Chemat Brand, TRC, Dr. Ehrenstorfer, Biosynth. Available pack sizes: on request, 25mg, 0,5mg, 100mg.
Ergosine is an ergot alkaloid isolated from the fungus Epichloe typhina. It has a role as a fungal metabolite. It derives from a hydride of an ergotaman.
Source: ChEBI
| Molecular formula | C30H37N5O5 |
|---|---|
| Molecular weight | 547.6 g/mol |
| IUPAC name | (6aR,9R)-N-[(1S,2S,4R,7S)-2-hydroxy-4-methyl-7-(2-methylpropyl)-5,8-dioxo-3-oxa-6,9-diazatricyclo[7.3.0.02,6]dodecan-4-yl]-7-methyl-6,6a,8,9-tetrahydro-4H-indolo[4,3-fg]quinoline-9-carboxamide |
| InChIKey | NESVMZOPWPCFAU-ZPRCMDFASA-N |
| SMILES | CC(C)C[C@H]1C(=O)N2CCC[C@H]2[C@]3(N1C(=O)[C@](O3)(C)NC(=O)[C@H]4CN([C@@H]5CC6=CNC7=CC=CC(=C67)C5=C4)C)O |
Computed by PubChem (NCBI)