CAS 561027-72-3 is the registry number for 2-(1H-Indol-3-yl)-2-oxoethyl 5-bromonicotinate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
[2-(1H-indol-3-yl)-2-oxoethyl] 5-bromopyridine-3-carboxylate (CAS 561027-72-3) is a chemical compound with the molecular formula C16H11BrN2O3 and a molecular weight of 359.17 g/mol. IUPAC name: [2-(1H-indol-3-yl)-2-oxoethyl] 5-bromopyridine-3-carboxylate. InChIKey: JDXXZGUTEZEIKQ-UHFFFAOYSA-N.
| Molecular formula | C16H11BrN2O3 |
|---|---|
| Molecular weight | 359.17 g/mol |
| IUPAC name | [2-(1H-indol-3-yl)-2-oxoethyl] 5-bromopyridine-3-carboxylate |
| InChIKey | JDXXZGUTEZEIKQ-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=CN2)C(=O)COC(=O)C3=CC(=CN=C3)Br |
Computed by PubChem (NCBI)