CAS 561328-70-9 is the registry number for Potassium (pyridin-2-yl)trifluoroborate, 96%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
Potassium trifluoro(pyridin-2-yl)boranuide (CAS 561328-70-9) is a chemical compound with the molecular formula C5H4BF3KN and a molecular weight of 185.00 g/mol. IUPAC name: potassium trifluoro(pyridin-2-yl)boranuide. InChIKey: VXCPQBPINNXCOS-UHFFFAOYSA-N.
| Molecular formula | C5H4BF3KN |
|---|---|
| Molecular weight | 185.00 g/mol |
| IUPAC name | potassium trifluoro(pyridin-2-yl)boranuide |
| InChIKey | VXCPQBPINNXCOS-UHFFFAOYSA-N |
| SMILES | [B-](C1=CC=CC=N1)(F)(F)F.[K+] |
Computed by PubChem (NCBI)