CAS 56136-70-0 is the registry number for 4-Nitro-N1-(propan-2-yl)benzene-1,2-diamine. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
4-nitro-1-N-propan-2-ylbenzene-1,2-diamine (CAS 56136-70-0) is a chemical compound with the molecular formula C9H13N3O2 and a molecular weight of 195.22 g/mol. IUPAC name: 4-nitro-1-N-propan-2-ylbenzene-1,2-diamine. InChIKey: VMCJUOGTRRIILY-UHFFFAOYSA-N.
| Molecular formula | C9H13N3O2 |
|---|---|
| Molecular weight | 195.22 g/mol |
| IUPAC name | 4-nitro-1-N-propan-2-ylbenzene-1,2-diamine |
| InChIKey | VMCJUOGTRRIILY-UHFFFAOYSA-N |
| SMILES | CC(C)NC1=C(C=C(C=C1)[N+](=O)[O-])N |
Computed by PubChem (NCBI)