CAS 56138-96-6 appears in our catalog under these names: 2,6–Bis(diphenylmethyl)–4–methylbenzenamine, 2,6-Dibenzhydryl-4-methylaniline 90%, 2,6-dibenzhydryl-4-Methylaniline, 90%, 90%, 2,6-Bis(diphenylmethyl)-4-methylbenzenamine, 98%. Offered by: GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 25g, 5g, 100mg, 250mg, 1g.
2,6-dibenzhydryl-4-methylaniline (CAS 56138-96-6) is a chemical compound with the molecular formula C33H29N and a molecular weight of 439.6 g/mol. IUPAC name: 2,6-dibenzhydryl-4-methylaniline. InChIKey: NCXCFZUKRMOFHW-UHFFFAOYSA-N.
| Molecular formula | C33H29N |
|---|---|
| Molecular weight | 439.6 g/mol |
| IUPAC name | 2,6-dibenzhydryl-4-methylaniline |
| InChIKey | NCXCFZUKRMOFHW-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C(=C1)C(C2=CC=CC=C2)C3=CC=CC=C3)N)C(C4=CC=CC=C4)C5=CC=CC=C5 |
Computed by PubChem (NCBI)