CAS 56163-70-3 is the registry number for 5-(4-Chloro-phenyl)-3-hydroxy-1-methyl-1H-pyrrole-2,4-dicarboxylic Acid Diethyl Ester. Offered by: TRC. Available pack sizes: 100mg.
Diethyl 5-(4-chlorophenyl)-3-hydroxy-1-methylpyrrole-2,4-dicarboxylate (CAS 56163-70-3) is a chemical compound with the molecular formula C17H18ClNO5 and a molecular weight of 351.8 g/mol. IUPAC name: diethyl 5-(4-chlorophenyl)-3-hydroxy-1-methylpyrrole-2,4-dicarboxylate. InChIKey: LMSGXGYSVIDWJS-UHFFFAOYSA-N.
| Molecular formula | C17H18ClNO5 |
|---|---|
| Molecular weight | 351.8 g/mol |
| IUPAC name | diethyl 5-(4-chlorophenyl)-3-hydroxy-1-methylpyrrole-2,4-dicarboxylate |
| InChIKey | LMSGXGYSVIDWJS-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=C(N(C(=C1O)C(=O)OCC)C)C2=CC=C(C=C2)Cl |
Computed by PubChem (NCBI)