CAS 56173-05-8 appears in our catalog under these names: PCAF-IN-2, 98%, PCAF–IN–2, PCAF-IN-2 99%, 6-Hydrazineyl-3-(trifluoromethyl)-[1,2,4]triazolo[3,4-a]phthalazine, 99%, 99%, PCAF-IN-2, 98.0%. Offered by: AmBeed, GLPBio, Chemat, MedChemExpress. Available pack sizes: 5mg, 10mg, 25mg, 50mg, 100mg, 250mg, 5 mg, 10 mg.
[3-(trifluoromethyl)-[1,2,4]triazolo[3,4-a]phthalazin-6-yl]hydrazine (CAS 56173-05-8) is a chemical compound with the molecular formula C10H7F3N6 and a molecular weight of 268.20 g/mol. IUPAC name: [3-(trifluoromethyl)-[1,2,4]triazolo[3,4-a]phthalazin-6-yl]hydrazine. InChIKey: VXUZXROYRSNHSD-UHFFFAOYSA-N.
| Molecular formula | C10H7F3N6 |
|---|---|
| Molecular weight | 268.20 g/mol |
| IUPAC name | [3-(trifluoromethyl)-[1,2,4]triazolo[3,4-a]phthalazin-6-yl]hydrazine |
| InChIKey | VXUZXROYRSNHSD-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=NN3C2=NN=C3C(F)(F)F)NN |
Computed by PubChem (NCBI)