CAS 56176-31-9 appears in our catalog under these names: N-Dansyl-D-phenylalanine, >95% (HPLC), N-Dansyl-D-phenylalanine. Offered by: TRC, Biosynth. Available pack sizes: 250mg, 0,5g.
(2R)-2-[[5-(dimethylamino)naphthalen-1-yl]sulfonylamino]-3-phenylpropanoic acid (CAS 56176-31-9) is a chemical compound with the molecular formula C21H22N2O4S and a molecular weight of 398.5 g/mol. IUPAC name: (2R)-2-[[5-(dimethylamino)naphthalen-1-yl]sulfonylamino]-3-phenylpropanoic acid. InChIKey: GPIOGTIFRDHWSB-GOSISDBHSA-N.
| Molecular formula | C21H22N2O4S |
|---|---|
| Molecular weight | 398.5 g/mol |
| IUPAC name | (2R)-2-[[5-(dimethylamino)naphthalen-1-yl]sulfonylamino]-3-phenylpropanoic acid |
| InChIKey | GPIOGTIFRDHWSB-GOSISDBHSA-N |
| SMILES | CN(C)C1=CC=CC2=C1C=CC=C2S(=O)(=O)N[C@H](CC3=CC=CC=C3)C(=O)O |
Computed by PubChem (NCBI)