CAS 56177-75-4 is the registry number for 2-(3,4-Dichlorophenyl)-2,2-difluoroethan-1-amine hydrochloride. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
2-(3,4-dichlorophenyl)-2,2-difluoroethanamine;hydrochloride (CAS 56177-75-4) is a chemical compound with the molecular formula C8H8Cl3F2N and a molecular weight of 262.5 g/mol. IUPAC name: 2-(3,4-dichlorophenyl)-2,2-difluoroethanamine;hydrochloride. InChIKey: IDRGAYFUKYBZAF-UHFFFAOYSA-N.
| Molecular formula | C8H8Cl3F2N |
|---|---|
| Molecular weight | 262.5 g/mol |
| IUPAC name | 2-(3,4-dichlorophenyl)-2,2-difluoroethanamine;hydrochloride |
| InChIKey | IDRGAYFUKYBZAF-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1C(CN)(F)F)Cl)Cl.Cl |
Computed by PubChem (NCBI)