CAS 56187-93-0 is the registry number for 4-(Phenyl-d5)-3-buten-2-one. Offered by: TRC. Available pack sizes: 50mg, 5mg.
(E)-4-(2,3,4,5,6-pentadeuteriophenyl)but-3-en-2-one (CAS 56187-93-0) is a chemical compound with the molecular formula C10H10O and a molecular weight of 151.22 g/mol. IUPAC name: (E)-4-(2,3,4,5,6-pentadeuteriophenyl)but-3-en-2-one. InChIKey: BWHOZHOGCMHOBV-XLKVIOBLSA-N.
| Molecular formula | C10H10O |
|---|---|
| Molecular weight | 151.22 g/mol |
| IUPAC name | (E)-4-(2,3,4,5,6-pentadeuteriophenyl)but-3-en-2-one |
| InChIKey | BWHOZHOGCMHOBV-XLKVIOBLSA-N |
| SMILES | [2H]C1=C(C(=C(C(=C1[2H])[2H])/C=C/C(=O)C)[2H])[2H] |
Computed by PubChem (NCBI)