CAS 562-90-3 appears in our catalog under these names: Silicon tetraacetate, 95%, Silicon(IV) acetate, Silicon(IV) acetate, Silicon(IV) acetate , Tetraacetoxysilane, >95.0%(T). Offered by: Combi-blocks, Chemat, GLPBio, Thermo Scientific (Alfa Aesar), TCI. Available pack sizes: 50g, 250g, 100g, 25g, 5g, 10G.
Triacetyloxysilyl acetate (CAS 562-90-3) is a chemical compound with the molecular formula C8H12O8Si and a molecular weight of 264.26 g/mol. IUPAC name: triacetyloxysilyl acetate. InChIKey: YZVRVDPMGYFCGL-UHFFFAOYSA-N.
| Molecular formula | C8H12O8Si |
|---|---|
| Molecular weight | 264.26 g/mol |
| IUPAC name | triacetyloxysilyl acetate |
| InChIKey | YZVRVDPMGYFCGL-UHFFFAOYSA-N |
| SMILES | CC(=O)O[Si](OC(=O)C)(OC(=O)C)OC(=O)C |
Computed by PubChem (NCBI)