CAS 562101-38-6 appears in our catalog under these names: Pyrimidine-2-carboxylic acid sodium, 95%, Sodium pyrimidine-2-carboxylate 95%, Sodium pyrimidine-2-carboxylate, 95%, 95%. Offered by: Combi-blocks, Ambeed, Chemat. Available pack sizes: 5g, 1g, 10g, 250mg.
Sodium pyrimidine-2-carboxylate (CAS 562101-38-6) is a chemical compound with the molecular formula C5H3N2NaO2 and a molecular weight of 146.08 g/mol. IUPAC name: sodium pyrimidine-2-carboxylate. InChIKey: JAYHOLAWADPIFN-UHFFFAOYSA-M.
| Molecular formula | C5H3N2NaO2 |
|---|---|
| Molecular weight | 146.08 g/mol |
| IUPAC name | sodium pyrimidine-2-carboxylate |
| InChIKey | JAYHOLAWADPIFN-UHFFFAOYSA-M |
| SMILES | C1=CN=C(N=C1)C(=O)[O-].[Na+] |
Computed by PubChem (NCBI)