CAS 5628-56-8 appears in our catalog under these names: Methyl 4-hydroxy-2,3-dimethylbenzoate, 95%, Methyl 4–Hydroxy–2,3–dimethylbenzoate, Methyl 4-Hydroxy-2,3-dimethylbenzoate, >95%, >95%, METHYL 4-HYDROXY-2,3-DIMETHYLBENZOATE, >95%. Offered by: Combi-blocks, GLPBio, Chemat, Fluorochem. Available pack sizes: 5g, 1g.
Methyl 4-hydroxy-2,3-dimethylbenzoate (CAS 5628-56-8) is a chemical compound with the molecular formula C10H12O3 and a molecular weight of 180.20 g/mol. IUPAC name: methyl 4-hydroxy-2,3-dimethylbenzoate. InChIKey: YRTMTNQHJZLDOA-UHFFFAOYSA-N.
| Molecular formula | C10H12O3 |
|---|---|
| Molecular weight | 180.20 g/mol |
| IUPAC name | methyl 4-hydroxy-2,3-dimethylbenzoate |
| InChIKey | YRTMTNQHJZLDOA-UHFFFAOYSA-N |
| SMILES | CC1=C(C=CC(=C1C)O)C(=O)OC |
Computed by PubChem (NCBI)