CAS 562858-09-7 is the registry number for 1-(5-Trifluoromethyl-(1,3,4)thiadiazol-2-yl)-piperazine. Offered by: Biosynth. Available pack sizes: 1000mg, 500mg.
2-piperazin-1-yl-5-(trifluoromethyl)-1,3,4-thiadiazole (CAS 562858-09-7) is a chemical compound with the molecular formula C7H9F3N4S and a molecular weight of 238.24 g/mol. IUPAC name: 2-piperazin-1-yl-5-(trifluoromethyl)-1,3,4-thiadiazole. InChIKey: HCHPSOYHPOLYCC-UHFFFAOYSA-N.
| Molecular formula | C7H9F3N4S |
|---|---|
| Molecular weight | 238.24 g/mol |
| IUPAC name | 2-piperazin-1-yl-5-(trifluoromethyl)-1,3,4-thiadiazole |
| InChIKey | HCHPSOYHPOLYCC-UHFFFAOYSA-N |
| SMILES | C1CN(CCN1)C2=NN=C(S2)C(F)(F)F |
Computed by PubChem (NCBI)