CAS 56292-88-7 is the registry number for 1,4-Cyclohexanedione Monoethylene Acetal-d4. Offered by: TRC. Available pack sizes: 500mg.
7,7,9,9-tetradeuterio-1,4-dioxaspiro[4.5]decan-8-one (CAS 56292-88-7) is a chemical compound with the molecular formula C8H12O3 and a molecular weight of 160.20 g/mol. IUPAC name: 7,7,9,9-tetradeuterio-1,4-dioxaspiro[4.5]decan-8-one. InChIKey: VKRKCBWIVLSRBJ-LNLMKGTHSA-N.
| Molecular formula | C8H12O3 |
|---|---|
| Molecular weight | 160.20 g/mol |
| IUPAC name | 7,7,9,9-tetradeuterio-1,4-dioxaspiro[4.5]decan-8-one |
| InChIKey | VKRKCBWIVLSRBJ-LNLMKGTHSA-N |
| SMILES | [2H]C1(CC2(CC(C1=O)([2H])[2H])OCCO2)[2H] |
Computed by PubChem (NCBI)