CAS 56296-18-5 appears in our catalog under these names: DREADD agonist 21, Dreadd agonist 21, 95%, DREADD Agonist 21, DREADD agonist 21/ 98.27% (existing batch purity), 11-Piperazinyldibenzo(b,e)(1,4)diazepine. Offered by: GLPBio, Combi-blocks, TRC, TargetMol, Biosynth. Available pack sizes: 5mg, 100mg, 250mg, 500mg, 2mg, 10mg, 25mg, 50mg.
6-piperazin-1-yl-11H-benzo[b][1,4]benzodiazepine (CAS 56296-18-5) is a chemical compound with the molecular formula C17H18N4 and a molecular weight of 278.35 g/mol. IUPAC name: 6-piperazin-1-yl-11H-benzo[b][1,4]benzodiazepine. InChIKey: JCBYXNSOLUVGTF-UHFFFAOYSA-N.
| Molecular formula | C17H18N4 |
|---|---|
| Molecular weight | 278.35 g/mol |
| IUPAC name | 6-piperazin-1-yl-11H-benzo[b][1,4]benzodiazepine |
| InChIKey | JCBYXNSOLUVGTF-UHFFFAOYSA-N |
| SMILES | C1CN(CCN1)C2=NC3=CC=CC=C3NC4=CC=CC=C42 |
Computed by PubChem (NCBI)