CAS 5632-16-6 appears in our catalog under these names: 4-(Bromomethyl)quinoline, 95%, 4–(Bromomethyl)quinoline. Offered by: Combi-blocks, AmBeed, GLPBio. Available pack sizes: 1g, 250mg, 5g.
4-(bromomethyl)quinoline (CAS 5632-16-6) is a chemical compound with the molecular formula C10H8BrN and a molecular weight of 222.08 g/mol. IUPAC name: 4-(bromomethyl)quinoline. InChIKey: QJQXVPCIRZUOIP-UHFFFAOYSA-N.
| Molecular formula | C10H8BrN |
|---|---|
| Molecular weight | 222.08 g/mol |
| IUPAC name | 4-(bromomethyl)quinoline |
| InChIKey | QJQXVPCIRZUOIP-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=CC=N2)CBr |
Computed by PubChem (NCBI)