CAS 5632-29-1 appears in our catalog under these names: 2,2':5',2'':5'',2'''-Quaterthiophene, 95%, α–Quaterthiophene, alpha-Quaterthiophene, 2,2':5',2":5",2'''-QUATERTHIOPHENE, 96%, 2,2':5',2'':5'',2'''-Quaterthiophene, 97%, 97%. Offered by: Combi-blocks, GLPBio, TCI, Sigma-Aldrich, Chemat. Available pack sizes: 100mg, 500mg, 1G, 250mg, 5g.
2-thiophen-2-yl-5-(5-thiophen-2-ylthiophen-2-yl)thiophene (CAS 5632-29-1) is a chemical compound with the molecular formula C16H10S4 and a molecular weight of 330.5 g/mol. IUPAC name: 2-thiophen-2-yl-5-(5-thiophen-2-ylthiophen-2-yl)thiophene. InChIKey: FXEJOIFDICYSSO-UHFFFAOYSA-N.
| Molecular formula | C16H10S4 |
|---|---|
| Molecular weight | 330.5 g/mol |
| IUPAC name | 2-thiophen-2-yl-5-(5-thiophen-2-ylthiophen-2-yl)thiophene |
| InChIKey | FXEJOIFDICYSSO-UHFFFAOYSA-N |
| SMILES | C1=CSC(=C1)C2=CC=C(S2)C3=CC=C(S3)C4=CC=CS4 |
Computed by PubChem (NCBI)