Products 56329-27-2

CAS 56329-27-2 is the registry number for Diethylamine NONOate diethylammonium salt, 98%, 98%. Offered by: Chemat. Available pack sizes: 5mg, 10mg, 50mg.

Structural formula: {0} (CAS {1})

N-(diethylamino)-N-oxidonitrous amide;diethylazanium (CAS 56329-27-2) is a chemical compound with the molecular formula C8H22N4O2 and a molecular weight of 206.29 g/mol. IUPAC name: N-(diethylamino)-N-oxidonitrous amide;diethylazanium. InChIKey: YMXHDQWHPBQRQP-UHFFFAOYSA-O.

Identity
Molecular formulaC8H22N4O2
Molecular weight206.29 g/mol
IUPAC nameN-(diethylamino)-N-oxidonitrous amide;diethylazanium
InChIKeyYMXHDQWHPBQRQP-UHFFFAOYSA-O
SMILESCC[NH2+]CC.CCN(CC)N(N=O)[O-]

Computed by PubChem (NCBI)