CAS 5633-55-6 appears in our catalog under these names: 4-(Phenylsulfanyl)phenol, 95-<97%, 4-(phenylsulfanyl)phenol, >95% (HPLC), 4-(Phenylsulfanyl)phenol 95%, 4-(Phenylsulfanyl)phenol, 95%, 95%, 4-(Phenylsulfanyl)phenol, 95%. Offered by: Hoffman Fine Chemicals, TRC, Ambeed, Chemat, Fluorochem. Available pack sizes: 5g, 10g, 25g, 50g, 100g, 1g, 2,5g, 250mg.
4-phenylsulfanylphenol (CAS 5633-55-6) is a chemical compound with the molecular formula C12H10OS and a molecular weight of 202.27 g/mol. IUPAC name: 4-phenylsulfanylphenol. InChIKey: XAYCNCYFKLSMGR-UHFFFAOYSA-N.
| Molecular formula | C12H10OS |
|---|---|
| Molecular weight | 202.27 g/mol |
| IUPAC name | 4-phenylsulfanylphenol |
| InChIKey | XAYCNCYFKLSMGR-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)SC2=CC=C(C=C2)O |
Computed by PubChem (NCBI)