Products 5634-41-3

CAS 5634-41-3 is the registry number for Parapenzolate (bromide). Offered by: MedChemExpress. Available pack sizes: Get quote.

Structural formula: {0} (CAS {1})

(1,1-dimethylpiperidin-1-ium-4-yl) 2-hydroxy-2,2-diphenylacetate bromide (CAS 5634-41-3) is a chemical compound with the molecular formula C21H26BrNO3 and a molecular weight of 420.3 g/mol. IUPAC name: (1,1-dimethylpiperidin-1-ium-4-yl) 2-hydroxy-2,2-diphenylacetate bromide. InChIKey: NHTZWXHFTDRAEO-UHFFFAOYSA-M.

Identity
Molecular formulaC21H26BrNO3
Molecular weight420.3 g/mol
IUPAC name(1,1-dimethylpiperidin-1-ium-4-yl) 2-hydroxy-2,2-diphenylacetate bromide
InChIKeyNHTZWXHFTDRAEO-UHFFFAOYSA-M
SMILESC[N+]1(CCC(CC1)OC(=O)C(C2=CC=CC=C2)(C3=CC=CC=C3)O)C.[Br-]

Computed by PubChem (NCBI)