CAS 5634-41-3 is the registry number for Parapenzolate (bromide). Offered by: MedChemExpress. Available pack sizes: Get quote.
(1,1-dimethylpiperidin-1-ium-4-yl) 2-hydroxy-2,2-diphenylacetate bromide (CAS 5634-41-3) is a chemical compound with the molecular formula C21H26BrNO3 and a molecular weight of 420.3 g/mol. IUPAC name: (1,1-dimethylpiperidin-1-ium-4-yl) 2-hydroxy-2,2-diphenylacetate bromide. InChIKey: NHTZWXHFTDRAEO-UHFFFAOYSA-M.
| Molecular formula | C21H26BrNO3 |
|---|---|
| Molecular weight | 420.3 g/mol |
| IUPAC name | (1,1-dimethylpiperidin-1-ium-4-yl) 2-hydroxy-2,2-diphenylacetate bromide |
| InChIKey | NHTZWXHFTDRAEO-UHFFFAOYSA-M |
| SMILES | C[N+]1(CCC(CC1)OC(=O)C(C2=CC=CC=C2)(C3=CC=CC=C3)O)C.[Br-] |
Computed by PubChem (NCBI)