CAS 56341-31-2 appears in our catalog under these names: 2-Bromoxanthone, 2-Bromoxanthone 95%, 2–Bromo–9H–xanthen–9–one, 2-Bromo-9H-xanthen-9-one, 98%, 2-Bromo-9H-xanthen-9-one, 95%, 95%. Offered by: TRC, Ambeed, GLPBio, Fluorochem, Chemat. Available pack sizes: 5g, 1g, 25g, 100g, 500g, 500mg, 250mg, 10g.
2-bromoxanthen-9-one (CAS 56341-31-2) is a chemical compound with the molecular formula C13H7BrO2 and a molecular weight of 275.10 g/mol. IUPAC name: 2-bromoxanthen-9-one. InChIKey: DYQUGFRRGGOYCA-UHFFFAOYSA-N.
| Molecular formula | C13H7BrO2 |
|---|---|
| Molecular weight | 275.10 g/mol |
| IUPAC name | 2-bromoxanthen-9-one |
| InChIKey | DYQUGFRRGGOYCA-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=O)C3=C(O2)C=CC(=C3)Br |
Computed by PubChem (NCBI)