CAS 56348-72-2 is the registry number for 3,3',4,4'-TetraCDE. Offered by: TRC. Available pack sizes: 10mg, 25mg, 50mg.
1,2-dichloro-4-(3,4-dichlorophenoxy)benzene (CAS 56348-72-2) is a chemical compound with the molecular formula C12H6Cl4O and a molecular weight of 308.0 g/mol. IUPAC name: 1,2-dichloro-4-(3,4-dichlorophenoxy)benzene. InChIKey: DHLVZXZRIZBPKG-UHFFFAOYSA-N.
| Molecular formula | C12H6Cl4O |
|---|---|
| Molecular weight | 308.0 g/mol |
| IUPAC name | 1,2-dichloro-4-(3,4-dichlorophenoxy)benzene |
| InChIKey | DHLVZXZRIZBPKG-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1OC2=CC(=C(C=C2)Cl)Cl)Cl)Cl |
Computed by PubChem (NCBI)