Products 56362-87-9
CAS 56362-87-9 is the registry number for rel-(3aR,7aR)-1-Ethylideneoctahydro-7a-methyl-1H-indene. Offered by: TRC. Available pack sizes: 100mg.
(3E,3aR,7aR)-3-ethylidene-3a-methyl-2,4,5,6,7,7a-hexahydro-1H-indene (CAS 56362-87-9) is a chemical compound with the molecular formula C12H20 and a molecular weight of 164.29 g/mol. IUPAC name: (3E,3aR,7aR)-3-ethylidene-3a-methyl-2,4,5,6,7,7a-hexahydro-1H-indene. InChIKey: PLNRDADPGQMIIQ-BKAIQDJRSA-N.
| Molecular formula | C12H20 |
|---|---|
| Molecular weight | 164.29 g/mol |
| IUPAC name | (3E,3aR,7aR)-3-ethylidene-3a-methyl-2,4,5,6,7,7a-hexahydro-1H-indene |
| InChIKey | PLNRDADPGQMIIQ-BKAIQDJRSA-N |
| SMILES | C/C=C/1\CC[C@@H]2[C@]1(CCCC2)C |
Computed by PubChem (NCBI)