CAS 564-10-3 appears in our catalog under these names: 3,3,3-Trifluoro-2-(trifluoromethyl)propionic acid, 95%, 3,3,3-Trifluoro-2-(trifluoromethyl)propionic acid, 97%, 3,3,3-Trifluoro-2-(trifluoromethyl)propanoic acid 95%, 3,3,3-TRIFLUORO-2-(TRIFLUOROMETHYL)-, 3,3,3-Trifluoro-2-(trifluoromethyl)propanoic acid, 95%, 95%. Offered by: Combi-blocks, Thermo Scientific (Acros), Ambeed, Sigma-Aldrich, Chemat. Available pack sizes: 25g, 5g, 1g, 100mg, 250mg.
3,3,3-trifluoro-2-(trifluoromethyl)propanoic acid (CAS 564-10-3) is a chemical compound with the molecular formula C4H2F6O2 and a molecular weight of 196.05 g/mol. IUPAC name: 3,3,3-trifluoro-2-(trifluoromethyl)propanoic acid. InChIKey: RAEAYTICAPHWJW-UHFFFAOYSA-N.
| Molecular formula | C4H2F6O2 |
|---|---|
| Molecular weight | 196.05 g/mol |
| IUPAC name | 3,3,3-trifluoro-2-(trifluoromethyl)propanoic acid |
| InChIKey | RAEAYTICAPHWJW-UHFFFAOYSA-N |
| SMILES | C(C(=O)O)(C(F)(F)F)C(F)(F)F |
Computed by PubChem (NCBI)