CAS 56403-29-3 is the registry number for 1,4-Bis(bromomethyl)-2,5-diiodobenzene. Offered by: TRC. Available pack sizes: 1g.
1,4-bis(bromomethyl)-2,5-diiodobenzene (CAS 56403-29-3) is a chemical compound with the molecular formula C8H6Br2I2 and a molecular weight of 515.75 g/mol. IUPAC name: 1,4-bis(bromomethyl)-2,5-diiodobenzene. InChIKey: RNXBYLAAAKTAQY-UHFFFAOYSA-N.
| Molecular formula | C8H6Br2I2 |
|---|---|
| Molecular weight | 515.75 g/mol |
| IUPAC name | 1,4-bis(bromomethyl)-2,5-diiodobenzene |
| InChIKey | RNXBYLAAAKTAQY-UHFFFAOYSA-N |
| SMILES | C1=C(C(=CC(=C1I)CBr)I)CBr |
Computed by PubChem (NCBI)