Products 56417-02-8
CAS 56417-02-8 is the registry number for L-Alanyl-L-glutamine Impurity 7. Offered by: Chemat Brand. Available pack sizes: on request.
(2S)-2-amino-5-[[(2S)-1-[[(1S)-1-carboxyethyl]amino]-1-oxopropan-2-yl]amino]-5-oxopentanoic acid (CAS 56417-02-8) is a chemical compound with the molecular formula C11H19N3O6 and a molecular weight of 289.29 g/mol. IUPAC name: (2S)-2-amino-5-[[(2S)-1-[[(1S)-1-carboxyethyl]amino]-1-oxopropan-2-yl]amino]-5-oxopentanoic acid. InChIKey: XTIIDMYRJQKDNA-ACZMJKKPSA-N.
| Molecular formula | C11H19N3O6 |
|---|---|
| Molecular weight | 289.29 g/mol |
| IUPAC name | (2S)-2-amino-5-[[(2S)-1-[[(1S)-1-carboxyethyl]amino]-1-oxopropan-2-yl]amino]-5-oxopentanoic acid |
| InChIKey | XTIIDMYRJQKDNA-ACZMJKKPSA-N |
| SMILES | C[C@@H](C(=O)N[C@@H](C)C(=O)O)NC(=O)CC[C@@H](C(=O)O)N |
Computed by PubChem (NCBI)