Products 56421-88-6

CAS 56421-88-6 is the registry number for 2-(3-Thienyl)pyrimidine, 95-<97%. Offered by: Hoffman Fine Chemicals. Available pack sizes: 2,5g, 5g, 10g, 25g, 50g.

Structural formula: {0} (CAS {1})

2-thiophen-3-ylpyrimidine (CAS 56421-88-6) is a chemical compound with the molecular formula C8H6N2S and a molecular weight of 162.21 g/mol. IUPAC name: 2-thiophen-3-ylpyrimidine. InChIKey: JSZNHWCHEOFXAY-UHFFFAOYSA-N.

Identity
Molecular formulaC8H6N2S
Molecular weight162.21 g/mol
IUPAC name2-thiophen-3-ylpyrimidine
InChIKeyJSZNHWCHEOFXAY-UHFFFAOYSA-N
SMILESC1=CN=C(N=C1)C2=CSC=C2

Computed by PubChem (NCBI)