Products 564482-79-7
CAS 564482-79-7 is the registry number for DCFBC. Offered by: MedChemExpress. Available pack sizes: Get quote.
(2S)-2-[[(1R)-1-carboxy-2-[(4-fluorophenyl)methylsulfanyl]ethyl]carbamoylamino]pentanedioic acid (CAS 564482-79-7) is a chemical compound with the molecular formula C16H19FN2O7S and a molecular weight of 402.4 g/mol. IUPAC name: (2S)-2-[[(1R)-1-carboxy-2-[(4-fluorophenyl)methylsulfanyl]ethyl]carbamoylamino]pentanedioic acid. InChIKey: IDTMSHGCAZPVLC-RYUDHWBXSA-N.
| Molecular formula | C16H19FN2O7S |
|---|---|
| Molecular weight | 402.4 g/mol |
| IUPAC name | (2S)-2-[[(1R)-1-carboxy-2-[(4-fluorophenyl)methylsulfanyl]ethyl]carbamoylamino]pentanedioic acid |
| InChIKey | IDTMSHGCAZPVLC-RYUDHWBXSA-N |
| SMILES | C1=CC(=CC=C1CSC[C@@H](C(=O)O)NC(=O)N[C@@H](CCC(=O)O)C(=O)O)F |
Computed by PubChem (NCBI)