CAS 564483-19-8 appears in our catalog under these names: 2–Di–tert–butylphosphino–2′,4′,6′–triisopropylbiphenyl, 2-Di-tert-butylphosphino-2',4',6'-triisopropylbiphenyl, 2-Di-tert-butylphosphino-2',4',6'-triisopropylbiphenyl, >98.0%(T)(qNMR), t-BuXPhos 98%, TBUXPHOS CHEMBEADS. Offered by: GLPBio, Biosynth, TCI, Ambeed, Sigma-Aldrich. Available pack sizes: 100g, 25g, 5g, 0,25kg, 0,1kg, 1g, 0,5kg, 10kg.
Ditert-butyl-[2-[2,4,6-tri(propan-2-yl)phenyl]phenyl]phosphane (CAS 564483-19-8) is a chemical compound with the molecular formula C29H45P and a molecular weight of 424.6 g/mol. IUPAC name: ditert-butyl-[2-[2,4,6-tri(propan-2-yl)phenyl]phenyl]phosphane. InChIKey: SACNIGZYDTUHKB-UHFFFAOYSA-N.
| Molecular formula | C29H45P |
|---|---|
| Molecular weight | 424.6 g/mol |
| IUPAC name | ditert-butyl-[2-[2,4,6-tri(propan-2-yl)phenyl]phenyl]phosphane |
| InChIKey | SACNIGZYDTUHKB-UHFFFAOYSA-N |
| SMILES | CC(C)C1=CC(=C(C(=C1)C(C)C)C2=CC=CC=C2P(C(C)(C)C)C(C)(C)C)C(C)C |
Computed by PubChem (NCBI)