Products 56475-13-9

CAS 56475-13-9 is the registry number for 2-Chlorocyclohex-1-ene-1-carboxylic acid. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.

Structural formula: {0} (CAS {1})

2-chlorocyclohexene-1-carboxylic acid (CAS 56475-13-9) is a chemical compound with the molecular formula C7H9ClO2 and a molecular weight of 160.60 g/mol. IUPAC name: 2-chlorocyclohexene-1-carboxylic acid. InChIKey: ZODRKAXSGHOHFF-UHFFFAOYSA-N.

Identity
Molecular formulaC7H9ClO2
Molecular weight160.60 g/mol
IUPAC name2-chlorocyclohexene-1-carboxylic acid
InChIKeyZODRKAXSGHOHFF-UHFFFAOYSA-N
SMILESC1CCC(=C(C1)C(=O)O)Cl

Computed by PubChem (NCBI)